C14H13BrO — CID 142152358
(2Z,4Z)-3-bromo-2-ethenyl-1-phenylhexa-2,4-dien-1-one (PubChem CID 142152358) has the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. Its IUPAC name is (2Z,4Z)-3-bromo-2-ethenyl-1-phenylhexa-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-3-bromo-2-ethenyl-1-phenylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 142152358 |
| Molecular Formula | C14H13BrO |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (2Z,4Z)-3-bromo-2-ethenyl-1-phenylhexa-2,4-dien-1-one |
| SMILES | C=C/C(C(=O)c1ccccc1)=C(Br)\C=C/C |
| InChI | InChI=1S/C14H13BrO/c1-3-8-13(15)12(4-2)14(16)11-9-6-5-7-10-11/h3-10H,2H2,1H3/b8-3-,13-12- |
| InChIKey | LJQOGIGNIZEIAO-VWFKJLBHSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|