C31H34FN3O2 — CID 142153388
(3Z)-3-[(2Z)-3-[4-(cyclopropylamino)piperidine-1-carbonyl]-2,5-dimethylhexa-2,4-dienylidene]-4-(3-fluorophenyl)-1H-indol-2-one (PubChem CID 142153388) has the molecular formula C31H34FN3O2 and a molecular weight of 499.63 g/mol. Its IUPAC name is (3Z)-3-[(2Z)-3-[4-(cyclopropylamino)piperidine-1-carbonyl]-2,5-dimethylhexa-2,4-dienylidene]-4-(3-fluorophenyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(2Z)-3-[4-(cyclopropylamino)piperidine-1-carbonyl]-2,5-dimethylhexa-2,4-dienylidene]-4-(3-fluorophenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 142153388 |
| Molecular Formula | C31H34FN3O2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (3Z)-3-[(2Z)-3-[4-(cyclopropylamino)piperidine-1-carbonyl]-2,5-dimethylhexa-2,4-dienylidene]-4-(3-fluorophenyl)-1H-indol-2-one |
| SMILES | CC(C)=C/C(C(=O)N1CCC(NC2CC2)CC1)=C(C)/C=C1\C(=O)Nc2cccc(-c3cccc(F)c3)c21 |
| InChI | InChI=1S/C31H34FN3O2/c1-19(2)16-26(31(37)35-14-12-24(13-15-35)33-23-10-11-23)20(3)17-27-29-25(21-6-4-7-22(32)18-21)8-5-9-28(29)34-30(27)36/h4-9,16-18,23-24,33H,10-15H2,1-3H3,(H,34,36)/b26-20-,27-17- |
| InChIKey | GIOHVINZIOZUIG-YMJGFCAMSA-N |
| XLogP | 5.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|