C25H32O6Si — CID 14215356
(4aR,6R,7S,8aS)-2-phenyl-7-phenylmethoxy-6-(2-trimethylsilylethoxy)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one (PubChem CID 14215356) has the molecular formula C25H32O6Si and a molecular weight of 456.61 g/mol. Its IUPAC name is (4aR,6R,7S,8aS)-2-phenyl-7-phenylmethoxy-6-(2-trimethylsilylethoxy)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one.
| Compound Name | (4aR,6R,7S,8aS)-2-phenyl-7-phenylmethoxy-6-(2-trimethylsilylethoxy)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one |
|---|---|
| PubChem CID | 14215356 |
| Molecular Formula | C25H32O6Si |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (4aR,6R,7S,8aS)-2-phenyl-7-phenylmethoxy-6-(2-trimethylsilylethoxy)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one |
| SMILES | C[Si](C)(C)CCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2C(=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H32O6Si/c1-32(2,3)15-14-27-25-23(28-16-18-10-6-4-7-11-18)21(26)22-20(30-25)17-29-24(31-22)19-12-8-5-9-13-19/h4-13,20,22-25H,14-17H2,1-3H3/t20-,22+,23-,24?,25-/m1/s1 |
| InChIKey | SARQLBCGPQYKBC-IQGHPWDQSA-N |
| XLogP | 4.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|