C35H48N4OS — CID 142153683
4-[3-[3-(azetidin-1-yl)propyl]-2-oxo-3,4-dihydroquinolin-1-yl]-N-[cycloheptyl(phenyl)methyl]piperidine-1-carbothioamide (PubChem CID 142153683) has the molecular formula C35H48N4OS and a molecular weight of 572.86 g/mol. Its IUPAC name is 4-[3-[3-(azetidin-1-yl)propyl]-2-oxo-3,4-dihydroquinolin-1-yl]-N-[cycloheptyl(phenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | 4-[3-[3-(azetidin-1-yl)propyl]-2-oxo-3,4-dihydroquinolin-1-yl]-N-[cycloheptyl(phenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 142153683 |
| Molecular Formula | C35H48N4OS |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 4-[3-[3-(azetidin-1-yl)propyl]-2-oxo-3,4-dihydroquinolin-1-yl]-N-[cycloheptyl(phenyl)methyl]piperidine-1-carbothioamide |
| SMILES | O=C1C(CCCN2CCC2)Cc2ccccc2N1C1CCN(C(=S)NC(c2ccccc2)C2CCCCCC2)CC1 |
| InChI | InChI=1S/C35H48N4OS/c40-34-30(17-10-21-37-22-11-23-37)26-29-16-8-9-18-32(29)39(34)31-19-24-38(25-20-31)35(41)36-33(28-14-6-3-7-15-28)27-12-4-1-2-5-13-27/h3,6-9,14-16,18,27,30-31,33H,1-2,4-5,10-13,17,19-26H2,(H,36,41) |
| InChIKey | CYIFUMYTGFAPJQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|