C29H43N5O2S — CID 142154053
[4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone;ethane;propane (PubChem CID 142154053) has the molecular formula C29H43N5O2S and a molecular weight of 525.76 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone;ethane;propane.
| Compound Name | [4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone;ethane;propane |
|---|---|
| PubChem CID | 142154053 |
| Molecular Formula | C29H43N5O2S |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | [4-amino-2-[4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-methylphenyl)methanone;ethane;propane |
| SMILES | CC.CCC.COCCN1CCN(c2ccc(Nc3nc(N)c(C(=O)c4cccc(C)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O2S.C3H8.C2H6/c1-17-4-3-5-18(16-17)21(30)22-23(25)27-24(32-22)26-19-6-8-20(9-7-19)29-12-10-28(11-13-29)14-15-31-2;1-3-2;1-2/h3-9,16H,10-15,25H2,1-2H3,(H,26,27);3H2,1-2H3;1-2H3 |
| InChIKey | CWFIRSUNTPLLTO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|