C23H24N6O2S — CID 142154063
3-[4-amino-2-[4-[4-(1-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzonitrile (PubChem CID 142154063) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-[4-amino-2-[4-[4-(1-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzonitrile.
| Compound Name | 3-[4-amino-2-[4-[4-(1-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 142154063 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-[4-amino-2-[4-[4-(1-hydroxyethyl)piperazin-1-yl]anilino]-1,3-thiazole-5-carbonyl]benzonitrile |
| SMILES | CC(O)N1CCN(c2ccc(Nc3nc(N)c(C(=O)c4cccc(C#N)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C23H24N6O2S/c1-15(30)28-9-11-29(12-10-28)19-7-5-18(6-8-19)26-23-27-22(25)21(32-23)20(31)17-4-2-3-16(13-17)14-24/h2-8,13,15,30H,9-12,25H2,1H3,(H,26,27) |
| InChIKey | VPLRCJPGYODHFP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|