C12H13F7N2 — CID 142154147
8-(2,2,3,3,4,4,4-heptafluorobutyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile (PubChem CID 142154147) has the molecular formula C12H13F7N2 and a molecular weight of 318.24 g/mol. Its IUPAC name is 8-(2,2,3,3,4,4,4-heptafluorobutyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile.
| Compound Name | 8-(2,2,3,3,4,4,4-heptafluorobutyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile |
|---|---|
| PubChem CID | 142154147 |
| Molecular Formula | C12H13F7N2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 8-(2,2,3,3,4,4,4-heptafluorobutyl)-8-azabicyclo[3.2.1]octane-3-carbonitrile |
| SMILES | N#CC1CC2CCC(C1)N2CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F7N2/c13-10(14,11(15,16)12(17,18)19)6-21-8-1-2-9(21)4-7(3-8)5-20/h7-9H,1-4,6H2 |
| InChIKey | ZFRMESOAKNDFGU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|