C13H21N2OP — CID 142154325
1-[4-[(2E,4Z,6E)-7-phosphanylhepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone (PubChem CID 142154325) has the molecular formula C13H21N2OP and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-[4-[(2E,4Z,6E)-7-phosphanylhepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(2E,4Z,6E)-7-phosphanylhepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142154325 |
| Molecular Formula | C13H21N2OP |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-[4-[(2E,4Z,6E)-7-phosphanylhepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone |
| SMILES | C/C=C(\C=C/C=C/P)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H21N2OP/c1-3-13(6-4-5-11-17)15-9-7-14(8-10-15)12(2)16/h3-6,11H,7-10,17H2,1-2H3/b6-4-,11-5+,13-3+ |
| InChIKey | UITIDZPCAGBNKR-PBWQKBKXSA-N |
| XLogP | 2.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|