C30H24N2O7 — CID 142154514
2-N,7-N-bis[(3,4-dihydroxyphenyl)methyl]-10-oxo-8H-benzo[a]azulene-2,7-dicarboxamide (PubChem CID 142154514) has the molecular formula C30H24N2O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is 2-N,7-N-bis[(3,4-dihydroxyphenyl)methyl]-10-oxo-8H-benzo[a]azulene-2,7-dicarboxamide.
| Compound Name | 2-N,7-N-bis[(3,4-dihydroxyphenyl)methyl]-10-oxo-8H-benzo[a]azulene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 142154514 |
| Molecular Formula | C30H24N2O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-N,7-N-bis[(3,4-dihydroxyphenyl)methyl]-10-oxo-8H-benzo[a]azulene-2,7-dicarboxamide |
| SMILES | O=C(NCc1ccc(O)c(O)c1)C1=CC=C2C(=CC1)C(=O)c1cc(C(=O)NCc3ccc(O)c(O)c3)ccc12 |
| InChI | InChI=1S/C30H24N2O7/c33-24-9-1-16(11-26(24)35)14-31-29(38)18-3-6-20-21-7-5-19(13-23(21)28(37)22(20)8-4-18)30(39)32-15-17-2-10-25(34)27(36)12-17/h1-3,5-13,33-36H,4,14-15H2,(H,31,38)(H,32,39) |
| InChIKey | CGOLEJSMDRKDBY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|