C22H31N5O — CID 142154924
2-[(Z)-(7-ethyl-4,8-dimethyl-3,4,5-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-9-ylidene)amino]oxy-N,N-dimethylethanamine;prop-1-ene (PubChem CID 142154924) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[(Z)-(7-ethyl-4,8-dimethyl-3,4,5-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-9-ylidene)amino]oxy-N,N-dimethylethanamine;prop-1-ene.
| Compound Name | 2-[(Z)-(7-ethyl-4,8-dimethyl-3,4,5-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-9-ylidene)amino]oxy-N,N-dimethylethanamine;prop-1-ene |
|---|---|
| PubChem CID | 142154924 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 2-[(Z)-(7-ethyl-4,8-dimethyl-3,4,5-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-9-ylidene)amino]oxy-N,N-dimethylethanamine;prop-1-ene |
| SMILES | C=CC.CCc1c(C)/c(=N/OCCN(C)C)c2ccccc2c2nn(C)nc12 |
| InChI | InChI=1S/C19H25N5O.C3H6/c1-6-14-13(2)17(22-25-12-11-23(3)4)15-9-7-8-10-16(15)19-18(14)20-24(5)21-19;1-3-2/h7-10H,6,11-12H2,1-5H3;3H,1H2,2H3/b22-17-; |
| InChIKey | UDLXGKQPHBAPAB-JJECXDOKSA-N |
| XLogP | 3.58 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|