C26H33ClF2N6O2 — CID 142154971
N-[(2E,3E)-3-(butylaminomethyl)-2-ethylidenehexa-3,5-dienyl]-2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]acetamide (PubChem CID 142154971) has the molecular formula C26H33ClF2N6O2 and a molecular weight of 535.04 g/mol. Its IUPAC name is N-[(2E,3E)-3-(butylaminomethyl)-2-ethylidenehexa-3,5-dienyl]-2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]acetamide.
| Compound Name | N-[(2E,3E)-3-(butylaminomethyl)-2-ethylidenehexa-3,5-dienyl]-2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 142154971 |
| Molecular Formula | C26H33ClF2N6O2 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N-[(2E,3E)-3-(butylaminomethyl)-2-ethylidenehexa-3,5-dienyl]-2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]acetamide |
| SMILES | C=C/C=C(CNCCCC)\C(=C/C)CNC(=O)Cn1c(Cl)cnc(NCC(F)(F)c2ccccn2)c1=O |
| InChI | InChI=1S/C26H33ClF2N6O2/c1-4-7-12-30-14-20(10-5-2)19(6-3)15-32-23(36)17-35-22(27)16-33-24(25(35)37)34-18-26(28,29)21-11-8-9-13-31-21/h5-6,8-11,13,16,30H,2,4,7,12,14-15,17-18H2,1,3H3,(H,32,36)(H,33,34)/b19-6-,20-10- |
| InChIKey | RXNIXAKHFRWOIS-SZMFZICBSA-N |
| XLogP | 4.06 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|