About 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne
2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne (PubChem CID 142155320) has the molecular formula C18H23BrClN
and a molecular weight of 368.75 g/mol. Its IUPAC name is 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne.
Molecular Properties
| Compound Name | 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne |
| PubChem CID | 142155320 |
| Molecular Formula | C18H23BrClN |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne |
| SMILES | C#CC.CC1=CC(C)c2ccc(Cl)cc2CC1.[H]/N=C/CBr |
| InChI | InChI=1S/C13H15Cl.C3H4.C2H4BrN/c1-9-3-4-11-8-12(14)5-6-13(11)10(2)7-9;1-3-2;3-1-2-4/h5-8,10H,3-4H2,1-2H3;1H,2H3;2,4H,1H2/b;;4-2+ |
| InChIKey | HYRHKHFTWRGHQY-KVDNZAPZSA-N |
| XLogP | 6.01 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne?
The IUPAC name of 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne (CID 142155320) is 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne.
What is the SMILES notation for 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne?
The canonical SMILES for 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne is C#CC.CC1=CC(C)c2ccc(Cl)cc2CC1.[H]/N=C/CBr.
What is the InChIKey of 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne?
The InChIKey is HYRHKHFTWRGHQY-KVDNZAPZSA-N. The full InChI is InChI=1S/C13H15Cl.C3H4.C2H4BrN/c1-9-3-4-11-8-12(14)5-6-13(11)10(2)7-9;1-3-2;3-1-2-4/h5-8,10H,3-4H2,1-2H3;1H,2H3;2,4H,1H2/b;;4-2+.
What are the key properties of 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne?
2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne has a molecular weight of 368.75 g/mol, XLogP of 6.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethanimine;2-chloro-5,7-dimethyl-8,9-dihydro-5H-benzo[7]annulene;prop-1-yne is sourced from PubChem (CID 142155320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).