C17H23NO2S — CID 142155595
(3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-ethenylhexa-3,5-dienoic acid;ethane (PubChem CID 142155595) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is (3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-ethenylhexa-3,5-dienoic acid;ethane.
| Compound Name | (3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-ethenylhexa-3,5-dienoic acid;ethane |
|---|---|
| PubChem CID | 142155595 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-ethenylhexa-3,5-dienoic acid;ethane |
| SMILES | C=C/C=C(\C=C)C(C(=O)O)N1CCc2sccc2C1.CC |
| InChI | InChI=1S/C15H17NO2S.C2H6/c1-3-5-11(4-2)14(15(17)18)16-8-6-13-12(10-16)7-9-19-13;1-2/h3-5,7,9,14H,1-2,6,8,10H2,(H,17,18);1-2H3/b11-5+; |
| InChIKey | DZXCCGCEPOGTOX-HMXKFKBXSA-N |
| XLogP | 3.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|