About N-(3-methyl-1,3-thiazol-2-ylidene)formamide
N-(3-methyl-1,3-thiazol-2-ylidene)formamide (PubChem CID 142155624) has the molecular formula C5H6N2OS
and a molecular weight of 142.18 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)formamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)formamide |
| PubChem CID | 142155624 |
| Molecular Formula | C5H6N2OS |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)formamide |
| SMILES | Cn1ccs/c1=N\C=O |
| InChI | InChI=1S/C5H6N2OS/c1-7-2-3-9-5(7)6-4-8/h2-4H,1H3/b6-5- |
| InChIKey | QBALXELVUBPPFP-WAYWQWQTSA-N |
| XLogP | 0.14 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,3-thiazol-2-ylidene)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)formamide?
The IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)formamide (CID 142155624) is N-(3-methyl-1,3-thiazol-2-ylidene)formamide.
What is the SMILES notation for N-(3-methyl-1,3-thiazol-2-ylidene)formamide?
The canonical SMILES for N-(3-methyl-1,3-thiazol-2-ylidene)formamide is Cn1ccs/c1=N\C=O.
What is the InChIKey of N-(3-methyl-1,3-thiazol-2-ylidene)formamide?
The InChIKey is QBALXELVUBPPFP-WAYWQWQTSA-N. The full InChI is InChI=1S/C5H6N2OS/c1-7-2-3-9-5(7)6-4-8/h2-4H,1H3/b6-5-.
What are the key properties of N-(3-methyl-1,3-thiazol-2-ylidene)formamide?
N-(3-methyl-1,3-thiazol-2-ylidene)formamide has a molecular weight of 142.18 g/mol, XLogP of 0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,3-thiazol-2-ylidene)formamide is sourced from PubChem (CID 142155624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).