About 1-benzoxepine;ethane
1-benzoxepine;ethane (PubChem CID 142155637) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-benzoxepine;ethane.
Molecular Properties
| Compound Name | 1-benzoxepine;ethane |
| PubChem CID | 142155637 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1-benzoxepine;ethane |
| SMILES | C1=COc2ccccc2C=C1.CC |
| InChI | InChI=1S/C10H8O.C2H6/c1-2-7-10-9(5-1)6-3-4-8-11-10;1-2/h1-8H;1-2H3 |
| InChIKey | USKQDJLQVUNYIK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzoxepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzoxepine;ethane?
The IUPAC name of 1-benzoxepine;ethane (CID 142155637) is 1-benzoxepine;ethane.
What is the SMILES notation for 1-benzoxepine;ethane?
The canonical SMILES for 1-benzoxepine;ethane is C1=COc2ccccc2C=C1.CC.
What is the InChIKey of 1-benzoxepine;ethane?
The InChIKey is USKQDJLQVUNYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C2H6/c1-2-7-10-9(5-1)6-3-4-8-11-10;1-2/h1-8H;1-2H3.
What are the key properties of 1-benzoxepine;ethane?
1-benzoxepine;ethane has a molecular weight of 174.24 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzoxepine;ethane is sourced from PubChem (CID 142155637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).