C30H29Cl3N3O2P — CID 142155938
1-tert-butyl-4-[4-(2-chloro-4-phosphanylphenyl)-8-(2,6-dichlorophenyl)-7-oxo-1,8-naphthyridin-2-yl]piperidine-4-carbaldehyde (PubChem CID 142155938) has the molecular formula C30H29Cl3N3O2P and a molecular weight of 600.91 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-(2-chloro-4-phosphanylphenyl)-8-(2,6-dichlorophenyl)-7-oxo-1,8-naphthyridin-2-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-tert-butyl-4-[4-(2-chloro-4-phosphanylphenyl)-8-(2,6-dichlorophenyl)-7-oxo-1,8-naphthyridin-2-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 142155938 |
| Molecular Formula | C30H29Cl3N3O2P |
| Molecular Weight | 600.91 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | 1-tert-butyl-4-[4-(2-chloro-4-phosphanylphenyl)-8-(2,6-dichlorophenyl)-7-oxo-1,8-naphthyridin-2-yl]piperidine-4-carbaldehyde |
| SMILES | CC(C)(C)N1CCC(C=O)(c2cc(-c3ccc(P)cc3Cl)c3ccc(=O)n(-c4c(Cl)cccc4Cl)c3n2)CC1 |
| InChI | InChI=1S/C30H29Cl3N3O2P/c1-29(2,3)35-13-11-30(17-37,12-14-35)25-16-21(19-8-7-18(39)15-24(19)33)20-9-10-26(38)36(28(20)34-25)27-22(31)5-4-6-23(27)32/h4-10,15-17H,11-14,39H2,1-3H3 |
| InChIKey | PGFJLPFGZSGKBL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.91 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|