C22H22F3N3O2 — CID 142157276
ethyl (E)-4,4,4-trifluoro-3-[[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]amino]but-2-enoate (PubChem CID 142157276) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-[[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]amino]but-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-[[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 142157276 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-[[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/Nc1nc2ccccc2n1-c1c(C)cc(C)cc1C)C(F)(F)F |
| InChI | InChI=1S/C22H22F3N3O2/c1-5-30-19(29)12-18(22(23,24)25)27-21-26-16-8-6-7-9-17(16)28(21)20-14(3)10-13(2)11-15(20)4/h6-12H,5H2,1-4H3,(H,26,27)/b18-12+ |
| InChIKey | TZFNQFASTGLBHE-LDADJPATSA-N |
| XLogP | 5.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|