C10H20O — CID 142157327
(2R)-2,4-diethyl-6-methyloxane (PubChem CID 142157327) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (2R)-2,4-diethyl-6-methyloxane.
| Compound Name | (2R)-2,4-diethyl-6-methyloxane |
|---|---|
| PubChem CID | 142157327 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (2R)-2,4-diethyl-6-methyloxane |
| SMILES | CCC1CC(C)O[C@H](CC)C1 |
| InChI | InChI=1S/C10H20O/c1-4-9-6-8(3)11-10(5-2)7-9/h8-10H,4-7H2,1-3H3/t8?,9?,10-/m1/s1 |
| InChIKey | GXNYUIWTWOWNQO-UDNWOFFPSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |