C29H37NO5S — CID 142157354
(1S,3S,11S,16R)-11-hydroxy-8,8,16-trimethyl-10,12-dimethylidene-3-[(E)-1-(6-methylthiopyran-3-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,7,9-trione (PubChem CID 142157354) has the molecular formula C29H37NO5S and a molecular weight of 511.68 g/mol. Its IUPAC name is (1S,3S,11S,16R)-11-hydroxy-8,8,16-trimethyl-10,12-dimethylidene-3-[(E)-1-(6-methylthiopyran-3-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,7,9-trione.
| Compound Name | (1S,3S,11S,16R)-11-hydroxy-8,8,16-trimethyl-10,12-dimethylidene-3-[(E)-1-(6-methylthiopyran-3-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,7,9-trione |
|---|---|
| PubChem CID | 142157354 |
| Molecular Formula | C29H37NO5S |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (1S,3S,11S,16R)-11-hydroxy-8,8,16-trimethyl-10,12-dimethylidene-3-[(E)-1-(6-methylthiopyran-3-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,7,9-trione |
| SMILES | C=C1CCC[C@@]2(C)O[C@H]2C[C@@H](/C(C)=C/C2=CSC(C)=C=C2)NC(=O)CC(=O)C(C)(C)C(=O)C(=C)[C@H]1O |
| InChI | InChI=1S/C29H37NO5S/c1-17-9-8-12-29(7)24(35-29)14-22(18(2)13-21-11-10-19(3)36-16-21)30-25(32)15-23(31)28(5,6)27(34)20(4)26(17)33/h11,13,16,22,24,26,33H,1,4,8-9,12,14-15H2,2-3,5-7H3,(H,30,32)/b18-13+/t22-,24-,26-,29+/m0/s1 |
| InChIKey | OYWYOKZMJRLDST-RGYFYRDOSA-N |
| XLogP | 4.87 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|