C24H25N5O2 — CID 142157586
6-(1,3-benzodioxol-5-yl)-N-(1-benzylpyrrolidin-3-yl)-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-imine (PubChem CID 142157586) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-N-(1-benzylpyrrolidin-3-yl)-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-imine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-N-(1-benzylpyrrolidin-3-yl)-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-imine |
|---|---|
| PubChem CID | 142157586 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-N-(1-benzylpyrrolidin-3-yl)-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-imine |
| SMILES | C1=CN2C=C(c3ccc4c(c3)OCO4)N/C(=N\C3CCN(Cc4ccccc4)C3)C2N1 |
| InChI | InChI=1S/C24H25N5O2/c1-2-4-17(5-3-1)13-28-10-8-19(14-28)26-23-24-25-9-11-29(24)15-20(27-23)18-6-7-21-22(12-18)31-16-30-21/h1-7,9,11-12,15,19,24-25H,8,10,13-14,16H2,(H,26,27) |
| InChIKey | VWFKGEGGIYGSJJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|