C24H21F2N5O5 — CID 142157881
N-[[4-[2-(1-aminoethylideneamino)-2-iminoethoxy]-2-fluorophenyl]methyl]-2-(1,3-benzodioxol-5-yloxy)-5-fluoropyridine-3-carboxamide (PubChem CID 142157881) has the molecular formula C24H21F2N5O5 and a molecular weight of 497.46 g/mol. Its IUPAC name is N-[[4-[2-(1-aminoethylideneamino)-2-iminoethoxy]-2-fluorophenyl]methyl]-2-(1,3-benzodioxol-5-yloxy)-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[[4-[2-(1-aminoethylideneamino)-2-iminoethoxy]-2-fluorophenyl]methyl]-2-(1,3-benzodioxol-5-yloxy)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 142157881 |
| Molecular Formula | C24H21F2N5O5 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-[[4-[2-(1-aminoethylideneamino)-2-iminoethoxy]-2-fluorophenyl]methyl]-2-(1,3-benzodioxol-5-yloxy)-5-fluoropyridine-3-carboxamide |
| SMILES | [H]/N=C(COc1ccc(CNC(=O)c2cc(F)cnc2Oc2ccc3c(c2)OCO3)c(F)c1)\N=C(/C)N |
| InChI | InChI=1S/C24H21F2N5O5/c1-13(27)31-22(28)11-33-16-3-2-14(19(26)7-16)9-29-23(32)18-6-15(25)10-30-24(18)36-17-4-5-20-21(8-17)35-12-34-20/h2-8,10H,9,11-12H2,1H3,(H,29,32)(H3,27,28,31) |
| InChIKey | KWKNUGNGIQBHLF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|