C12H14N2O — CID 142158221
3,4,8,9,10,11-hexahydropyrimido[2,1-a]isoquinolin-2-one (PubChem CID 142158221) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3,4,8,9,10,11-hexahydropyrimido[2,1-a]isoquinolin-2-one.
| Compound Name | 3,4,8,9,10,11-hexahydropyrimido[2,1-a]isoquinolin-2-one |
|---|---|
| PubChem CID | 142158221 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3,4,8,9,10,11-hexahydropyrimido[2,1-a]isoquinolin-2-one |
| SMILES | O=C1CCN2C=CC3=C(CCCC3)C2=N1 |
| InChI | InChI=1S/C12H14N2O/c15-11-6-8-14-7-5-9-3-1-2-4-10(9)12(14)13-11/h5,7H,1-4,6,8H2 |
| InChIKey | STLCQFYTUGYHAN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |