C26H20O10 — CID 142158652
(2R)-4,9-dihydroxy-2-[6-(1-hydroxyethyl)-3-methyl-1-oxoisochromen-7-yl]oxy-2,7-dimethylbenzo[f][1]benzofuran-3,5,8-trione (PubChem CID 142158652) has the molecular formula C26H20O10 and a molecular weight of 492.44 g/mol. Its IUPAC name is (2R)-4,9-dihydroxy-2-[6-(1-hydroxyethyl)-3-methyl-1-oxoisochromen-7-yl]oxy-2,7-dimethylbenzo[f][1]benzofuran-3,5,8-trione.
| Compound Name | (2R)-4,9-dihydroxy-2-[6-(1-hydroxyethyl)-3-methyl-1-oxoisochromen-7-yl]oxy-2,7-dimethylbenzo[f][1]benzofuran-3,5,8-trione |
|---|---|
| PubChem CID | 142158652 |
| Molecular Formula | C26H20O10 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (2R)-4,9-dihydroxy-2-[6-(1-hydroxyethyl)-3-methyl-1-oxoisochromen-7-yl]oxy-2,7-dimethylbenzo[f][1]benzofuran-3,5,8-trione |
| SMILES | CC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)O[C@@](C)(Oc1cc2c(=O)oc(C)cc2cc1C(C)O)C3=O |
| InChI | InChI=1S/C26H20O10/c1-9-5-15(28)17-18(20(9)29)22(31)23-19(21(17)30)24(32)26(4,36-23)35-16-8-14-12(7-13(16)11(3)27)6-10(2)34-25(14)33/h5-8,11,27,30-31H,1-4H3/t11?,26-/m1/s1 |
| InChIKey | XHJMXSFDJMYOQL-ONGKMOKKSA-N |
| XLogP | 3.26 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|