C33H60O — CID 142158678
10,13-dimethyl-17-(5-methyl-4-methylidenehexyl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane;2-methylpropane (PubChem CID 142158678) has the molecular formula C33H60O and a molecular weight of 472.84 g/mol. Its IUPAC name is 10,13-dimethyl-17-(5-methyl-4-methylidenehexyl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane;2-methylpropane.
| Compound Name | 10,13-dimethyl-17-(5-methyl-4-methylidenehexyl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane;2-methylpropane |
|---|---|
| PubChem CID | 142158678 |
| Molecular Formula | C33H60O |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 472.46 |
| IUPAC Name | 10,13-dimethyl-17-(5-methyl-4-methylidenehexyl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane;2-methylpropane |
| SMILES | C=C(CCCC1CCC2C3=CCC4CC(O)CCC4(C)C3CCC12C)C(C)C.CC.CC(C)C |
| InChI | InChI=1S/C27H44O.C4H10.C2H6/c1-18(2)19(3)7-6-8-20-10-12-24-23-11-9-21-17-22(28)13-15-27(21,5)25(23)14-16-26(20,24)4;1-4(2)3;1-2/h11,18,20-22,24-25,28H,3,6-10,12-17H2,1-2,4-5H3;4H,1-3H3;1-2H3 |
| InChIKey | YTTUOLFWEINDCC-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|