C19H24N2O2 — CID 142159900
10,16,16-trimethyl-6-(methylamino)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 142159900) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 10,16,16-trimethyl-6-(methylamino)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 10,16,16-trimethyl-6-(methylamino)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 142159900 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 10,16,16-trimethyl-6-(methylamino)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CNc1cc(=O)oc2c3c4c(cc12)C(C)CCN4CCC3(C)C |
| InChI | InChI=1S/C19H24N2O2/c1-11-5-7-21-8-6-19(2,3)16-17(21)12(11)9-13-14(20-4)10-15(22)23-18(13)16/h9-11,20H,5-8H2,1-4H3 |
| InChIKey | RXPWXTOYXJCXPT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|