C17H14N2O5S2 — CID 142160039
(5Z)-5-[[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)but-2-enoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 142160039) has the molecular formula C17H14N2O5S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is (5Z)-5-[[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)but-2-enoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)but-2-enoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142160039 |
| Molecular Formula | C17H14N2O5S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | (5Z)-5-[[4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)but-2-enoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCC=CCN3C(=O)CSC3=O)cc2)S1 |
| InChI | InChI=1S/C17H14N2O5S2/c20-14-10-25-17(23)19(14)7-1-2-8-24-12-5-3-11(4-6-12)9-13-15(21)18-16(22)26-13/h1-6,9H,7-8,10H2,(H,18,21,22)/b2-1?,13-9- |
| InChIKey | YLNRCAKTVFLWJD-RCPXMSRMSA-N |
| XLogP | 2.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|