C18H21FN4O4 — CID 142161201
2-(2,2-dimethoxyethylamino)-6-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]oxy-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 142161201) has the molecular formula C18H21FN4O4 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylamino)-6-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]oxy-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(2,2-dimethoxyethylamino)-6-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]oxy-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142161201 |
| Molecular Formula | C18H21FN4O4 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(2,2-dimethoxyethylamino)-6-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]oxy-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=C/C=C(/Oc1cc2cnc(NCC(OC)OC)nc2n(C)c1=O)C(=C)F |
| InChI | InChI=1S/C18H21FN4O4/c1-6-7-13(11(2)19)27-14-8-12-9-20-18(21-10-15(25-4)26-5)22-16(12)23(3)17(14)24/h6-9,15H,1-2,10H2,3-5H3,(H,20,21,22)/b13-7+ |
| InChIKey | JJAHGZPXLNNYEF-NTUHNPAUSA-N |
| XLogP | 2.29 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|