C31H39ClFN5O4 — CID 142161715
N-(5-chloro-2-pyridinyl)-2-[[(2Z,4E,6Z)-3-(2-ethoxyethoxy)-2-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-2,4,6-trienoyl]amino]-5-fluorobenzamide (PubChem CID 142161715) has the molecular formula C31H39ClFN5O4 and a molecular weight of 600.14 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[(2Z,4E,6Z)-3-(2-ethoxyethoxy)-2-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-2,4,6-trienoyl]amino]-5-fluorobenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[(2Z,4E,6Z)-3-(2-ethoxyethoxy)-2-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-2,4,6-trienoyl]amino]-5-fluorobenzamide |
|---|---|
| PubChem CID | 142161715 |
| Molecular Formula | C31H39ClFN5O4 |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[(2Z,4E,6Z)-3-(2-ethoxyethoxy)-2-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-2,4,6-trienoyl]amino]-5-fluorobenzamide |
| SMILES | C/C=C\C(=C/C(OCCOCC)=C(\C)C(=O)Nc1ccc(F)cc1C(=O)Nc1ccc(Cl)cn1)N1CCCN(C)CC1 |
| InChI | InChI=1S/C31H39ClFN5O4/c1-5-8-25(38-14-7-13-37(4)15-16-38)20-28(42-18-17-41-6-2)22(3)30(39)35-27-11-10-24(33)19-26(27)31(40)36-29-12-9-23(32)21-34-29/h5,8-12,19-21H,6-7,13-18H2,1-4H3,(H,35,39)(H,34,36,40)/b8-5-,25-20+,28-22- |
| InChIKey | IYPZVBGADBXGNI-YRSJUSQJSA-N |
| XLogP | 5.49 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|