C16H25F6NO3 — CID 142161838
ethane;(2E,3Z)-2-ethylidene-N-methoxy-N-methylhexa-3,5-dienamide;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol (PubChem CID 142161838) has the molecular formula C16H25F6NO3 and a molecular weight of 393.37 g/mol. Its IUPAC name is ethane;(2E,3Z)-2-ethylidene-N-methoxy-N-methylhexa-3,5-dienamide;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol.
| Compound Name | ethane;(2E,3Z)-2-ethylidene-N-methoxy-N-methylhexa-3,5-dienamide;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 142161838 |
| Molecular Formula | C16H25F6NO3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | ethane;(2E,3Z)-2-ethylidene-N-methoxy-N-methylhexa-3,5-dienamide;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol |
| SMILES | C=C/C=C\C(=C/C)C(=O)N(C)OC.CC.CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15NO2.C4H4F6O.C2H6/c1-5-7-8-9(6-2)10(12)11(3)13-4;1-2(11,3(5,6)7)4(8,9)10;1-2/h5-8H,1H2,2-4H3;11H,1H3;1-2H3/b8-7-,9-6+;; |
| InChIKey | LNQMUAQHXDXBQA-NVZZFEHSSA-N |
| XLogP | 4.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|