C21H34O2 — CID 142161926
(Z)-13-(3,6-dihydro-2H-pyran-2-yl)-6,12-dimethyl-10-methylidenetridec-2-en-4-one (PubChem CID 142161926) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (Z)-13-(3,6-dihydro-2H-pyran-2-yl)-6,12-dimethyl-10-methylidenetridec-2-en-4-one.
| Compound Name | (Z)-13-(3,6-dihydro-2H-pyran-2-yl)-6,12-dimethyl-10-methylidenetridec-2-en-4-one |
|---|---|
| PubChem CID | 142161926 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (Z)-13-(3,6-dihydro-2H-pyran-2-yl)-6,12-dimethyl-10-methylidenetridec-2-en-4-one |
| SMILES | C=C(CCCC(C)CC(=O)/C=C\C)CC(C)CC1CC=CCO1 |
| InChI | InChI=1S/C21H34O2/c1-5-9-20(22)15-18(3)11-8-10-17(2)14-19(4)16-21-12-6-7-13-23-21/h5-7,9,18-19,21H,2,8,10-16H2,1,3-4H3/b9-5- |
| InChIKey | ZPONFRJZXRPCLF-UITAMQMPSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|