C21H32N2O3 — CID 142162034
3-[(2E,4Z)-6-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)hepta-2,4,6-trien-3-yl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 142162034) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 3-[(2E,4Z)-6-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)hepta-2,4,6-trien-3-yl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2E,4Z)-6-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)hepta-2,4,6-trien-3-yl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142162034 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 3-[(2E,4Z)-6-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)hepta-2,4,6-trien-3-yl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(/C=C\C(=C/C)N1CC(CO)OC1=O)N1CCC2CCCCCC2C1 |
| InChI | InChI=1S/C21H32N2O3/c1-3-19(23-14-20(15-24)26-21(23)25)10-9-16(2)22-12-11-17-7-5-4-6-8-18(17)13-22/h3,9-10,17-18,20,24H,2,4-8,11-15H2,1H3/b10-9-,19-3+ |
| InChIKey | GWBVJZIYHKYOEX-DJGYFXAPSA-N |
| XLogP | 3.68 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|