C11H20N2 — CID 142162049
(4Z)-N-ethenyl-4-ethylidene-1-methylpiperidin-3-imine;methane (PubChem CID 142162049) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (4Z)-N-ethenyl-4-ethylidene-1-methylpiperidin-3-imine;methane.
| Compound Name | (4Z)-N-ethenyl-4-ethylidene-1-methylpiperidin-3-imine;methane |
|---|---|
| PubChem CID | 142162049 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (4Z)-N-ethenyl-4-ethylidene-1-methylpiperidin-3-imine;methane |
| SMILES | C.C=C/N=C1\CN(C)CC\C1=C\C |
| InChI | InChI=1S/C10H16N2.CH4/c1-4-9-6-7-12(3)8-10(9)11-5-2;/h4-5H,2,6-8H2,1,3H3;1H4/b9-4-,11-10+; |
| InChIKey | ROPSMXIFYKMNNU-AFLSZMNUSA-N |
| XLogP | 2.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|