C10H19N3O — CID 142163134
2-(4-methoxybutyl)-N,N-dimethylpyrazol-3-amine (PubChem CID 142163134) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(4-methoxybutyl)-N,N-dimethylpyrazol-3-amine.
| Compound Name | 2-(4-methoxybutyl)-N,N-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 142163134 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-(4-methoxybutyl)-N,N-dimethylpyrazol-3-amine |
| SMILES | COCCCCn1nccc1N(C)C |
| InChI | InChI=1S/C10H19N3O/c1-12(2)10-6-7-11-13(10)8-4-5-9-14-3/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | FHPQXZKTAVTCTB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|