C9H13FN4 — CID 142163841
(2-fluoro-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)hydrazine (PubChem CID 142163841) has the molecular formula C9H13FN4 and a molecular weight of 196.23 g/mol. Its IUPAC name is (2-fluoro-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-fluoro-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 142163841 |
| Molecular Formula | C9H13FN4 |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2-fluoro-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1nc(F)nc2c1CCCCC2 |
| InChI | InChI=1S/C9H13FN4/c10-9-12-7-5-3-1-2-4-6(7)8(13-9)14-11/h1-5,11H2,(H,12,13,14) |
| InChIKey | VGJDTGRJDBNSEH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|