About (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine
(2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine (PubChem CID 142163887) has the molecular formula C7H9FN4
and a molecular weight of 168.18 g/mol. Its IUPAC name is (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine |
| PubChem CID | 142163887 |
| Molecular Formula | C7H9FN4 |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1nc(F)nc2c1CCC2 |
| InChI | InChI=1S/C7H9FN4/c8-7-10-5-3-1-2-4(5)6(11-7)12-9/h1-3,9H2,(H,10,11,12) |
| InChIKey | NAMHYTNECCKWPT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine?
The IUPAC name of (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine (CID 142163887) is (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine.
What is the SMILES notation for (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine?
The canonical SMILES for (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine is NNc1nc(F)nc2c1CCC2.
What is the InChIKey of (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine?
The InChIKey is NAMHYTNECCKWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN4/c8-7-10-5-3-1-2-4(5)6(11-7)12-9/h1-3,9H2,(H,10,11,12).
What are the key properties of (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine?
(2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine has a molecular weight of 168.18 g/mol, XLogP of 0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)hydrazine is sourced from PubChem (CID 142163887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).