About ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine
ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine (PubChem CID 142163967) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine.
Molecular Properties
| Compound Name | ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine |
| PubChem CID | 142163967 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine |
| SMILES | C=CN.CC(C)=CC(C)OCCCC1CCN(C)CC1 |
| InChI | InChI=1S/C15H29NO.C2H5N/c1-13(2)12-14(3)17-11-5-6-15-7-9-16(4)10-8-15;1-2-3/h12,14-15H,5-11H2,1-4H3;2H,1,3H2 |
| InChIKey | SPLZMOIBZXYFST-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine?
The IUPAC name of ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine (CID 142163967) is ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine.
What is the SMILES notation for ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine?
The canonical SMILES for ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine is C=CN.CC(C)=CC(C)OCCCC1CCN(C)CC1.
What is the InChIKey of ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine?
The InChIKey is SPLZMOIBZXYFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO.C2H5N/c1-13(2)12-14(3)17-11-5-6-15-7-9-16(4)10-8-15;1-2-3/h12,14-15H,5-11H2,1-4H3;2H,1,3H2.
What are the key properties of ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine?
ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine has a molecular weight of 282.47 g/mol, XLogP of 3.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;1-methyl-4-[3-(4-methylpent-3-en-2-yloxy)propyl]piperidine is sourced from PubChem (CID 142163967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).