About 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate
3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate (PubChem CID 142163985) has the molecular formula C10H18N4S2
and a molecular weight of 258.42 g/mol. Its IUPAC name is 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate |
| PubChem CID | 142163985 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)SCCCSc1nc(C)cn1C |
| InChI | InChI=1S/C10H18N4S2/c1-8-7-14(3)10(13-8)16-6-4-5-15-9(11)12-2/h7H,4-6H2,1-3H3,(H2,11,12) |
| InChIKey | IEUQDIAEBUTTKA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate?
The IUPAC name of 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate (CID 142163985) is 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate.
What is the SMILES notation for 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate?
The canonical SMILES for 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate is C/N=C(\N)SCCCSc1nc(C)cn1C.
What is the InChIKey of 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate?
The InChIKey is IEUQDIAEBUTTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4S2/c1-8-7-14(3)10(13-8)16-6-4-5-15-9(11)12-2/h7H,4-6H2,1-3H3,(H2,11,12).
What are the key properties of 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate?
3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate has a molecular weight of 258.42 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dimethylimidazol-2-yl)sulfanylpropyl N'-methylcarbamimidothioate is sourced from PubChem (CID 142163985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).