C11H14N2O2 — CID 142164220
3-(cyclohexa-1,5-dien-1-ylmethyl)piperazine-2,5-dione (PubChem CID 142164220) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(cyclohexa-1,5-dien-1-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3-(cyclohexa-1,5-dien-1-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 142164220 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-(cyclohexa-1,5-dien-1-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1CNC(=O)C(CC2=CCCC=C2)N1 |
| InChI | InChI=1S/C11H14N2O2/c14-10-7-12-11(15)9(13-10)6-8-4-2-1-3-5-8/h2,4-5,9H,1,3,6-7H2,(H,12,15)(H,13,14) |
| InChIKey | FNRXYLVPIYPIPQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |