C11H14O2 — CID 142164339
5-ethyl-5-methylcyclohepta[d][1,3]dioxole (PubChem CID 142164339) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-ethyl-5-methylcyclohepta[d][1,3]dioxole.
| Compound Name | 5-ethyl-5-methylcyclohepta[d][1,3]dioxole |
|---|---|
| PubChem CID | 142164339 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 5-ethyl-5-methylcyclohepta[d][1,3]dioxole |
| SMILES | CCC1(C)C=CC=C2OCOC2=C1 |
| InChI | InChI=1S/C11H14O2/c1-3-11(2)6-4-5-9-10(7-11)13-8-12-9/h4-7H,3,8H2,1-2H3 |
| InChIKey | BMMRGELLZFXFAZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |