About 5-ethyl-5-methylcyclohepta[d][1,3]dioxole
5-ethyl-5-methylcyclohepta[d][1,3]dioxole (PubChem CID 142164339) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-ethyl-5-methylcyclohepta[d][1,3]dioxole.
Molecular Properties
| Compound Name | 5-ethyl-5-methylcyclohepta[d][1,3]dioxole |
| PubChem CID | 142164339 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 5-ethyl-5-methylcyclohepta[d][1,3]dioxole |
| SMILES | CCC1(C)C=CC=C2OCOC2=C1 |
| InChI | InChI=1S/C11H14O2/c1-3-11(2)6-4-5-9-10(7-11)13-8-12-9/h4-7H,3,8H2,1-2H3 |
| InChIKey | BMMRGELLZFXFAZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-5-methylcyclohepta[d][1,3]dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-5-methylcyclohepta[d][1,3]dioxole?
The IUPAC name of 5-ethyl-5-methylcyclohepta[d][1,3]dioxole (CID 142164339) is 5-ethyl-5-methylcyclohepta[d][1,3]dioxole.
What is the SMILES notation for 5-ethyl-5-methylcyclohepta[d][1,3]dioxole?
The canonical SMILES for 5-ethyl-5-methylcyclohepta[d][1,3]dioxole is CCC1(C)C=CC=C2OCOC2=C1.
What is the InChIKey of 5-ethyl-5-methylcyclohepta[d][1,3]dioxole?
The InChIKey is BMMRGELLZFXFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-3-11(2)6-4-5-9-10(7-11)13-8-12-9/h4-7H,3,8H2,1-2H3.
What are the key properties of 5-ethyl-5-methylcyclohepta[d][1,3]dioxole?
5-ethyl-5-methylcyclohepta[d][1,3]dioxole has a molecular weight of 178.23 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-5-methylcyclohepta[d][1,3]dioxole is sourced from PubChem (CID 142164339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).