C19H25F4NO3 — CID 142164373
tert-butyl 4-[(3Z,5Z)-3-fluoro-2-methylidene-4-(trifluoromethyl)hepta-3,5-dienoyl]piperidine-1-carboxylate (PubChem CID 142164373) has the molecular formula C19H25F4NO3 and a molecular weight of 391.41 g/mol. Its IUPAC name is tert-butyl 4-[(3Z,5Z)-3-fluoro-2-methylidene-4-(trifluoromethyl)hepta-3,5-dienoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3Z,5Z)-3-fluoro-2-methylidene-4-(trifluoromethyl)hepta-3,5-dienoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142164373 |
| Molecular Formula | C19H25F4NO3 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | tert-butyl 4-[(3Z,5Z)-3-fluoro-2-methylidene-4-(trifluoromethyl)hepta-3,5-dienoyl]piperidine-1-carboxylate |
| SMILES | C=C(C(=O)C1CCN(C(=O)OC(C)(C)C)CC1)/C(F)=C(\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C19H25F4NO3/c1-6-7-14(19(21,22)23)15(20)12(2)16(25)13-8-10-24(11-9-13)17(26)27-18(3,4)5/h6-7,13H,2,8-11H2,1,3-5H3/b7-6-,15-14- |
| InChIKey | ULMHNAUZMIPFAN-HXDWTSBLSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|