About 10,10-dioxothioxanthen-9-one;ethane
10,10-dioxothioxanthen-9-one;ethane (PubChem CID 142164564) has the molecular formula C15H14O3S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 10,10-dioxothioxanthen-9-one;ethane.
Molecular Properties
| Compound Name | 10,10-dioxothioxanthen-9-one;ethane |
| PubChem CID | 142164564 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 10,10-dioxothioxanthen-9-one;ethane |
| SMILES | CC.O=C1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H8O3S.C2H6/c14-13-9-5-1-3-7-11(9)17(15,16)12-8-4-2-6-10(12)13;1-2/h1-8H;1-2H3 |
| InChIKey | DCFAYLUBLIJNED-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10,10-dioxothioxanthen-9-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dioxothioxanthen-9-one;ethane?
The IUPAC name of 10,10-dioxothioxanthen-9-one;ethane (CID 142164564) is 10,10-dioxothioxanthen-9-one;ethane.
What is the SMILES notation for 10,10-dioxothioxanthen-9-one;ethane?
The canonical SMILES for 10,10-dioxothioxanthen-9-one;ethane is CC.O=C1c2ccccc2S(=O)(=O)c2ccccc21.
What is the InChIKey of 10,10-dioxothioxanthen-9-one;ethane?
The InChIKey is DCFAYLUBLIJNED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O3S.C2H6/c14-13-9-5-1-3-7-11(9)17(15,16)12-8-4-2-6-10(12)13;1-2/h1-8H;1-2H3.
What are the key properties of 10,10-dioxothioxanthen-9-one;ethane?
10,10-dioxothioxanthen-9-one;ethane has a molecular weight of 274.34 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dioxothioxanthen-9-one;ethane is sourced from PubChem (CID 142164564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).