C15H14O3S — CID 142164564
10,10-dioxothioxanthen-9-one;ethane (PubChem CID 142164564) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is 10,10-dioxothioxanthen-9-one;ethane.
| Compound Name | 10,10-dioxothioxanthen-9-one;ethane |
|---|---|
| PubChem CID | 142164564 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 10,10-dioxothioxanthen-9-one;ethane |
| SMILES | CC.O=C1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H8O3S.C2H6/c14-13-9-5-1-3-7-11(9)17(15,16)12-8-4-2-6-10(12)13;1-2/h1-8H;1-2H3 |
| InChIKey | DCFAYLUBLIJNED-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |