(2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite

C10H10INO2 — CID 142164589

IUPAC(2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite
SMILESCc1cc2cc(OOI)cc(C)c2[nH]1
InChIInChI=1S/C10H10INO2/c1-6-3-9(13-14-11)5-8-4-7(2)12-10(6)8/h3-5,12H,1-2H3
InChIKeyJWVXCIFPOMJZLX-UHFFFAOYSA-N
MW303.10 g/mol
LogP3.45
Rot. Bonds2

About (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite

(2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite (PubChem CID 142164589) has the molecular formula C10H10INO2 and a molecular weight of 303.10 g/mol. Its IUPAC name is (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite.

Molecular Properties

Compound Name(2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite
PubChem CID142164589
Molecular FormulaC10H10INO2
Molecular Weight303.10 g/mol
Exact Mass302.98
IUPAC Name(2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite
SMILESCc1cc2cc(OOI)cc(C)c2[nH]1
InChIInChI=1S/C10H10INO2/c1-6-3-9(13-14-11)5-8-4-7(2)12-10(6)8/h3-5,12H,1-2H3
InChIKeyJWVXCIFPOMJZLX-UHFFFAOYSA-N
XLogP3.45
TPSA34.25 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.10
LogP ≤ 53.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite?
The IUPAC name of (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite (CID 142164589) is (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite.
What is the SMILES notation for (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite?
The canonical SMILES for (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite is Cc1cc2cc(OOI)cc(C)c2[nH]1.
What is the InChIKey of (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite?
The InChIKey is JWVXCIFPOMJZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10INO2/c1-6-3-9(13-14-11)5-8-4-7(2)12-10(6)8/h3-5,12H,1-2H3.
What are the key properties of (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite?
(2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite has a molecular weight of 303.10 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-dimethyl-1H-indol-5-yl)oxy hypoiodite is sourced from PubChem (CID 142164589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).