C10H9F5N2O2S — CID 142164714
2,2,3,3,3-pentafluoropropyl 2-(4-methylpyrimidin-2-yl)sulfanylacetate (PubChem CID 142164714) has the molecular formula C10H9F5N2O2S and a molecular weight of 316.25 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-(4-methylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-(4-methylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 142164714 |
| Molecular Formula | C10H9F5N2O2S |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-(4-methylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1ccnc(SCC(=O)OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H9F5N2O2S/c1-6-2-3-16-8(17-6)20-4-7(18)19-5-9(11,12)10(13,14)15/h2-3H,4-5H2,1H3 |
| InChIKey | WHPIRAAUDJVMSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|