C22H28N2O — CID 142164869
(2R)-N-[3-(dimethylamino)propyl]-2-[3-(1-phenylethenyl)phenyl]propanamide (PubChem CID 142164869) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (2R)-N-[3-(dimethylamino)propyl]-2-[3-(1-phenylethenyl)phenyl]propanamide.
| Compound Name | (2R)-N-[3-(dimethylamino)propyl]-2-[3-(1-phenylethenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 142164869 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (2R)-N-[3-(dimethylamino)propyl]-2-[3-(1-phenylethenyl)phenyl]propanamide |
| SMILES | C=C(c1ccccc1)c1cccc([C@@H](C)C(=O)NCCCN(C)C)c1 |
| InChI | InChI=1S/C22H28N2O/c1-17(19-10-6-5-7-11-19)20-12-8-13-21(16-20)18(2)22(25)23-14-9-15-24(3)4/h5-8,10-13,16,18H,1,9,14-15H2,2-4H3,(H,23,25)/t18-/m1/s1 |
| InChIKey | SYHHDZJDXQVPOM-GOSISDBHSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|