About 1-ethenyl-N,4-dimethylpiperazin-2-imine
1-ethenyl-N,4-dimethylpiperazin-2-imine (PubChem CID 142164985) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-ethenyl-N,4-dimethylpiperazin-2-imine.
Molecular Properties
| Compound Name | 1-ethenyl-N,4-dimethylpiperazin-2-imine |
| PubChem CID | 142164985 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-ethenyl-N,4-dimethylpiperazin-2-imine |
| SMILES | C=CN1CCN(C)C/C1=N\C |
| InChI | InChI=1S/C8H15N3/c1-4-11-6-5-10(3)7-8(11)9-2/h4H,1,5-7H2,2-3H3/b9-8+ |
| InChIKey | RRCCHXWHYZKZPV-CMDGGOBGSA-N |
| XLogP | 0.41 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-N,4-dimethylpiperazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-N,4-dimethylpiperazin-2-imine?
The IUPAC name of 1-ethenyl-N,4-dimethylpiperazin-2-imine (CID 142164985) is 1-ethenyl-N,4-dimethylpiperazin-2-imine.
What is the SMILES notation for 1-ethenyl-N,4-dimethylpiperazin-2-imine?
The canonical SMILES for 1-ethenyl-N,4-dimethylpiperazin-2-imine is C=CN1CCN(C)C/C1=N\C.
What is the InChIKey of 1-ethenyl-N,4-dimethylpiperazin-2-imine?
The InChIKey is RRCCHXWHYZKZPV-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H15N3/c1-4-11-6-5-10(3)7-8(11)9-2/h4H,1,5-7H2,2-3H3/b9-8+.
What are the key properties of 1-ethenyl-N,4-dimethylpiperazin-2-imine?
1-ethenyl-N,4-dimethylpiperazin-2-imine has a molecular weight of 153.23 g/mol, XLogP of 0.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-N,4-dimethylpiperazin-2-imine is sourced from PubChem (CID 142164985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).