C10H11NO2 — CID 142165560
4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 142165560) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | 4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 142165560 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | O=C1NC(=O)C2C3CC(C4CC43)C12 |
| InChI | InChI=1S/C10H11NO2/c12-9-7-5-2-6(4-1-3(4)5)8(7)10(13)11-9/h3-8H,1-2H2,(H,11,12,13) |
| InChIKey | VDYHFSFZQXGCNA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|