C19H18N2O4 — CID 142165611
(2R,6S)-4-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 142165611) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2R,6S)-4-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2R,6S)-4-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 142165611 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2R,6S)-4-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | COc1cc(N2C(=O)[C@@H]3C4CCC(C4)[C@@H]3C2=O)ccc1-c1cnco1 |
| InChI | InChI=1S/C19H18N2O4/c1-24-14-7-12(4-5-13(14)15-8-20-9-25-15)21-18(22)16-10-2-3-11(6-10)17(16)19(21)23/h4-5,7-11,16-17H,2-3,6H2,1H3/t10?,11?,16-,17+ |
| InChIKey | VLTILVNANOEELL-HEHVEWEESA-N |
| XLogP | 2.89 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|