About (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol
(2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol (PubChem CID 142165625) has the molecular formula C6H12F3NO
and a molecular weight of 171.16 g/mol. Its IUPAC name is (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol |
| PubChem CID | 142165625 |
| Molecular Formula | C6H12F3NO |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol |
| SMILES | CC(C[C@H](N)C(O)F)C(F)F |
| InChI | InChI=1S/C6H12F3NO/c1-3(5(7)8)2-4(10)6(9)11/h3-6,11H,2,10H2,1H3/t3?,4-,6?/m0/s1 |
| InChIKey | DCNFGADNHJAGEM-ZSGNRXJESA-N |
| XLogP | 0.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol?
The IUPAC name of (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol (CID 142165625) is (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol.
What is the SMILES notation for (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol?
The canonical SMILES for (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol is CC(C[C@H](N)C(O)F)C(F)F.
What is the InChIKey of (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol?
The InChIKey is DCNFGADNHJAGEM-ZSGNRXJESA-N. The full InChI is InChI=1S/C6H12F3NO/c1-3(5(7)8)2-4(10)6(9)11/h3-6,11H,2,10H2,1H3/t3?,4-,6?/m0/s1.
What are the key properties of (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol?
(2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol has a molecular weight of 171.16 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1,5,5-trifluoro-4-methylpentan-1-ol is sourced from PubChem (CID 142165625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).