C31H50FN3O2 — CID 142165683
N-tert-butyl-4-cyclohexyl-1-formylpiperidine-4-carboxamide;(3R)-3-(4-fluorophenyl)-1-propan-2-ylpiperidine (PubChem CID 142165683) has the molecular formula C31H50FN3O2 and a molecular weight of 515.76 g/mol. Its IUPAC name is N-tert-butyl-4-cyclohexyl-1-formylpiperidine-4-carboxamide;(3R)-3-(4-fluorophenyl)-1-propan-2-ylpiperidine.
| Compound Name | N-tert-butyl-4-cyclohexyl-1-formylpiperidine-4-carboxamide;(3R)-3-(4-fluorophenyl)-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 142165683 |
| Molecular Formula | C31H50FN3O2 |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.39 |
| IUPAC Name | N-tert-butyl-4-cyclohexyl-1-formylpiperidine-4-carboxamide;(3R)-3-(4-fluorophenyl)-1-propan-2-ylpiperidine |
| SMILES | CC(C)(C)NC(=O)C1(C2CCCCC2)CCN(C=O)CC1.CC(C)N1CCC[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H30N2O2.C14H20FN/c1-16(2,3)18-15(21)17(14-7-5-4-6-8-14)9-11-19(13-20)12-10-17;1-11(2)16-9-3-4-13(10-16)12-5-7-14(15)8-6-12/h13-14H,4-12H2,1-3H3,(H,18,21);5-8,11,13H,3-4,9-10H2,1-2H3/t;13-/m.0/s1 |
| InChIKey | CBAIIYNAOPZMCB-RSJBZBQMSA-N |
| XLogP | 6.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|