About 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine
4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine (PubChem CID 142165814) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine.
Molecular Properties
| Compound Name | 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine |
| PubChem CID | 142165814 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine |
| SMILES | C1=CC2CC2C(C2CCNCC2)=C1 |
| InChI | InChI=1S/C12H17N/c1-2-10-8-12(10)11(3-1)9-4-6-13-7-5-9/h1-3,9-10,12-13H,4-8H2 |
| InChIKey | IHKIVKJKHIOBFH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
The IUPAC name of 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine (CID 142165814) is 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine.
What is the SMILES notation for 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
The canonical SMILES for 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine is C1=CC2CC2C(C2CCNCC2)=C1.
What is the InChIKey of 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
The InChIKey is IHKIVKJKHIOBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-2-10-8-12(10)11(3-1)9-4-6-13-7-5-9/h1-3,9-10,12-13H,4-8H2.
What are the key properties of 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine has a molecular weight of 175.27 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine is sourced from PubChem (CID 142165814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).